ChemNet > CAS > 175201-70-4 4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid
175201-70-4 4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid
Produkt-Name |
4-(methylthio)-2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)butanoic acid |
Synonyme |
N-{[2-(methylsulfanyl)pyridin-3-yl]carbonyl}methionine |
Molekulare Formel |
C12H16N2O3S2 |
Molecular Weight |
300.397 |
InChI |
InChI=1/C12H16N2O3S2/c1-18-7-5-9(12(16)17)14-10(15)8-4-3-6-13-11(8)19-2/h3-4,6,9H,5,7H2,1-2H3,(H,14,15)(H,16,17) |
CAS Registry Number |
175201-70-4 |
Molecular Structure |
|
Dichte |
1.33g/cm3 |
Schmelzpunkt |
157℃ |
Siedepunkt |
572.1°C at 760 mmHg |
Brechungsindex |
1.612 |
Flammpunkt |
299.8°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|